C18H14F16O4 — CID 89153217
[2-cyclohexyl-3,3,5,5-tetrafluoro-6-hydroxy-2,4,6-tris(trifluoromethyl)oxan-4-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 89153217) has the molecular formula C18H14F16O4 and a molecular weight of 598.27 g/mol. Its IUPAC name is [2-cyclohexyl-3,3,5,5-tetrafluoro-6-hydroxy-2,4,6-tris(trifluoromethyl)oxan-4-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-cyclohexyl-3,3,5,5-tetrafluoro-6-hydroxy-2,4,6-tris(trifluoromethyl)oxan-4-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 89153217 |
| Molecular Formula | C18H14F16O4 |
| Molecular Weight | 598.27 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | [2-cyclohexyl-3,3,5,5-tetrafluoro-6-hydroxy-2,4,6-tris(trifluoromethyl)oxan-4-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1(C(F)(F)F)C(F)(F)C(O)(C(F)(F)F)OC(C2CCCCC2)(C(F)(F)F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H14F16O4/c1-7(11(19,20)21)9(35)37-12(17(29,30)31)13(22,23)10(16(26,27)28,8-5-3-2-4-6-8)38-15(36,14(12,24)25)18(32,33)34/h8,36H,1-6H2 |
| InChIKey | BRJMTFYBHGVSOD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.27 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|