About 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole
2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole (PubChem CID 89153235) has the molecular formula C22H16N2S2
and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole |
| PubChem CID | 89153235 |
| Molecular Formula | C22H16N2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole |
| SMILES | CN1C(=CC=Cc2nc3c(ccc4ccccc43)s2)Sc2ccccc21 |
| InChI | InChI=1S/C22H16N2S2/c1-24-17-9-4-5-10-18(17)26-21(24)12-6-11-20-23-22-16-8-3-2-7-15(16)13-14-19(22)25-20/h2-14H,1H3 |
| InChIKey | XTIJXUNDYUKRFG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole?
The IUPAC name of 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole (CID 89153235) is 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole.
What is the SMILES notation for 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole?
The canonical SMILES for 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole is CN1C(=CC=Cc2nc3c(ccc4ccccc43)s2)Sc2ccccc21.
What is the InChIKey of 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole?
The InChIKey is XTIJXUNDYUKRFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2S2/c1-24-17-9-4-5-10-18(17)26-21(24)12-6-11-20-23-22-16-8-3-2-7-15(16)13-14-19(22)25-20/h2-14H,1H3.
What are the key properties of 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole?
2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole has a molecular weight of 372.52 g/mol, XLogP of 6.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]benzo[e][1,3]benzothiazole is sourced from PubChem (CID 89153235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).