C36H47BF3N7O3 — CID 89153338
CID 89153338 (PubChem CID 89153338) has the molecular formula C36H47BF3N7O3 and a molecular weight of 693.62 g/mol.
| Compound Name | CID 89153338 |
|---|---|
| PubChem CID | 89153338 |
| Molecular Formula | C36H47BF3N7O3 |
| Molecular Weight | 693.62 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](CC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCN(C3CCN(C)CC3)CC2)cc(C(F)(F)F)c1N |
| InChI | InChI=1S/C36H47BF3N7O3/c1-43-11-7-27(8-12-43)44-16-18-46(19-17-44)34(49)26(20-24-21-29(36(38,39)40)33(41)30(37)22-24)23-32(48)45-13-9-28(10-14-45)47-15-6-25-4-2-3-5-31(25)42-35(47)50/h2-5,21-22,26-28H,6-20,23,41H2,1H3,(H,42,50)/t26-/m0/s1 |
| InChIKey | QRGFZBREJZGPHL-SANMLTNESA-N |
| XLogP | 2.95 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|