About prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate
prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate (PubChem CID 89153394) has the molecular formula C15H28N2O3
and a molecular weight of 284.40 g/mol. Its IUPAC name is prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate |
| PubChem CID | 89153394 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate |
| SMILES | C=C(C)OC(=O)NCCC1CCN(CCOCC)CC1 |
| InChI | InChI=1S/C15H28N2O3/c1-4-19-12-11-17-9-6-14(7-10-17)5-8-16-15(18)20-13(2)3/h14H,2,4-12H2,1,3H3,(H,16,18) |
| InChIKey | HHBSDRDDQQCWET-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate?
The IUPAC name of prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate (CID 89153394) is prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate.
What is the SMILES notation for prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate?
The canonical SMILES for prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate is C=C(C)OC(=O)NCCC1CCN(CCOCC)CC1.
What is the InChIKey of prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate?
The InChIKey is HHBSDRDDQQCWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-4-19-12-11-17-9-6-14(7-10-17)5-8-16-15(18)20-13(2)3/h14H,2,4-12H2,1,3H3,(H,16,18).
What are the key properties of prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate?
prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate has a molecular weight of 284.40 g/mol, XLogP of 2.38, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl N-[2-[1-(2-ethoxyethyl)piperidin-4-yl]ethyl]carbamate is sourced from PubChem (CID 89153394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).