4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid

C12H23F2NO5S2 — CID 89153445

IUPAC4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid
SMILESCCC(C(F)(F)C(CC)S(=O)(=O)N1CCCCC1)S(=O)(=O)O
InChIInChI=1S/C12H23F2NO5S2/c1-3-10(12(13,14)11(4-2)22(18,19)20)21(16,17)15-8-6-5-7-9-15/h10-11H,3-9H2,1-2H3,(H,18,19,20)
InChIKeyKVJRLFZMIQITOA-UHFFFAOYSA-N
MW363.45 g/mol
LogP1.88
Rot. Bonds7

About 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid

4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid (PubChem CID 89153445) has the molecular formula C12H23F2NO5S2 and a molecular weight of 363.45 g/mol. Its IUPAC name is 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid.

Molecular Properties

Compound Name4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid
PubChem CID89153445
Molecular FormulaC12H23F2NO5S2
Molecular Weight363.45 g/mol
Exact Mass363.10
IUPAC Name4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid
SMILESCCC(C(F)(F)C(CC)S(=O)(=O)N1CCCCC1)S(=O)(=O)O
InChIInChI=1S/C12H23F2NO5S2/c1-3-10(12(13,14)11(4-2)22(18,19)20)21(16,17)15-8-6-5-7-9-15/h10-11H,3-9H2,1-2H3,(H,18,19,20)
InChIKeyKVJRLFZMIQITOA-UHFFFAOYSA-N
XLogP1.88
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.45
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid?
The IUPAC name of 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid (CID 89153445) is 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid.
What is the SMILES notation for 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid?
The canonical SMILES for 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid is CCC(C(F)(F)C(CC)S(=O)(=O)N1CCCCC1)S(=O)(=O)O.
What is the InChIKey of 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid?
The InChIKey is KVJRLFZMIQITOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2NO5S2/c1-3-10(12(13,14)11(4-2)22(18,19)20)21(16,17)15-8-6-5-7-9-15/h10-11H,3-9H2,1-2H3,(H,18,19,20).
What are the key properties of 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid?
4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid has a molecular weight of 363.45 g/mol, XLogP of 1.88, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-5-piperidin-1-ylsulfonylheptane-3-sulfonic acid is sourced from PubChem (CID 89153445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).