C19H28F4O4S — CID 89153462
4-(2,3-dimethylundecoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 89153462) has the molecular formula C19H28F4O4S and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-(2,3-dimethylundecoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(2,3-dimethylundecoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 89153462 |
| Molecular Formula | C19H28F4O4S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-(2,3-dimethylundecoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCCCCCCCC(C)C(C)COc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C19H28F4O4S/c1-4-5-6-7-8-9-10-12(2)13(3)11-27-18-14(20)16(22)19(28(24,25)26)17(23)15(18)21/h12-13H,4-11H2,1-3H3,(H,24,25,26) |
| InChIKey | MGJGJLHXJCBRLU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|