C17H26F6 — CID 89153540
4-[2-(3,4-dimethylcyclopentyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylcyclopentane (PubChem CID 89153540) has the molecular formula C17H26F6 and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-[2-(3,4-dimethylcyclopentyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylcyclopentane.
| Compound Name | 4-[2-(3,4-dimethylcyclopentyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylcyclopentane |
|---|---|
| PubChem CID | 89153540 |
| Molecular Formula | C17H26F6 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 4-[2-(3,4-dimethylcyclopentyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylcyclopentane |
| SMILES | CC1CC(C(C2CC(C)C(C)C2)(C(F)(F)F)C(F)(F)F)CC1C |
| InChI | InChI=1S/C17H26F6/c1-9-5-13(6-10(9)2)15(16(18,19)20,17(21,22)23)14-7-11(3)12(4)8-14/h9-14H,5-8H2,1-4H3 |
| InChIKey | JSCMUDIUNANCIZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |