C10H12ClN3 — CID 89153619
4-chloro-5-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1H-pyrazol-3-amine (PubChem CID 89153619) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 4-chloro-5-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1H-pyrazol-3-amine.
| Compound Name | 4-chloro-5-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 89153619 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4-chloro-5-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-1H-pyrazol-3-amine |
| SMILES | C/C=C\C=C/C=C/c1[nH]nc(N)c1Cl |
| InChI | InChI=1S/C10H12ClN3/c1-2-3-4-5-6-7-8-9(11)10(12)14-13-8/h2-7H,1H3,(H3,12,13,14)/b3-2-,5-4-,7-6+ |
| InChIKey | SPGGSSANUVHZDA-MUVPYGFYSA-N |
| XLogP | 2.79 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|