About 4-hydroperoxycyclohexa-2,4-dien-1-amine
4-hydroperoxycyclohexa-2,4-dien-1-amine (PubChem CID 89153689) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 4-hydroperoxycyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-hydroperoxycyclohexa-2,4-dien-1-amine |
| PubChem CID | 89153689 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 4-hydroperoxycyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(OO)=CC1 |
| InChI | InChI=1S/C6H9NO2/c7-5-1-3-6(9-8)4-2-5/h1,3-5,8H,2,7H2 |
| InChIKey | CCJAUZKMPPZBIX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroperoxycyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroperoxycyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-hydroperoxycyclohexa-2,4-dien-1-amine (CID 89153689) is 4-hydroperoxycyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-hydroperoxycyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-hydroperoxycyclohexa-2,4-dien-1-amine is NC1C=CC(OO)=CC1.
What is the InChIKey of 4-hydroperoxycyclohexa-2,4-dien-1-amine?
The InChIKey is CCJAUZKMPPZBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c7-5-1-3-6(9-8)4-2-5/h1,3-5,8H,2,7H2.
What are the key properties of 4-hydroperoxycyclohexa-2,4-dien-1-amine?
4-hydroperoxycyclohexa-2,4-dien-1-amine has a molecular weight of 127.14 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroperoxycyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89153689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).