C8H10F3N — CID 89153760
(2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-amine (PubChem CID 89153760) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is (2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 89153760 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (2E,4Z)-6-(trifluoromethyl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-3-7(12)5-4-6(2)8(9,10)11/h3-5H,2,12H2,1H3/b5-4-,7-3+ |
| InChIKey | GJWAQYMLAKWLSH-SBYNAHCQSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|