About (E)-3-amino-2-methylhex-1-ene-1,6-diol
(E)-3-amino-2-methylhex-1-ene-1,6-diol (PubChem CID 89153782) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is (E)-3-amino-2-methylhex-1-ene-1,6-diol.
Molecular Properties
| Compound Name | (E)-3-amino-2-methylhex-1-ene-1,6-diol |
| PubChem CID | 89153782 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (E)-3-amino-2-methylhex-1-ene-1,6-diol |
| SMILES | C/C(=C\O)C(N)CCCO |
| InChI | InChI=1S/C7H15NO2/c1-6(5-10)7(8)3-2-4-9/h5,7,9-10H,2-4,8H2,1H3/b6-5+ |
| InChIKey | ZPFVBCLMUIXXKH-AATRIKPKSA-N |
| XLogP | 0.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-2-methylhex-1-ene-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-2-methylhex-1-ene-1,6-diol?
The IUPAC name of (E)-3-amino-2-methylhex-1-ene-1,6-diol (CID 89153782) is (E)-3-amino-2-methylhex-1-ene-1,6-diol.
What is the SMILES notation for (E)-3-amino-2-methylhex-1-ene-1,6-diol?
The canonical SMILES for (E)-3-amino-2-methylhex-1-ene-1,6-diol is C/C(=C\O)C(N)CCCO.
What is the InChIKey of (E)-3-amino-2-methylhex-1-ene-1,6-diol?
The InChIKey is ZPFVBCLMUIXXKH-AATRIKPKSA-N. The full InChI is InChI=1S/C7H15NO2/c1-6(5-10)7(8)3-2-4-9/h5,7,9-10H,2-4,8H2,1H3/b6-5+.
What are the key properties of (E)-3-amino-2-methylhex-1-ene-1,6-diol?
(E)-3-amino-2-methylhex-1-ene-1,6-diol has a molecular weight of 145.20 g/mol, XLogP of 0.55, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-2-methylhex-1-ene-1,6-diol is sourced from PubChem (CID 89153782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).