About (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine
(1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine (PubChem CID 89153784) has the molecular formula C9H14F3N
and a molecular weight of 193.21 g/mol. Its IUPAC name is (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine |
| PubChem CID | 89153784 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine |
| SMILES | CC1=C(C)[C@H](N)CCC1C(F)(F)F |
| InChI | InChI=1S/C9H14F3N/c1-5-6(2)8(13)4-3-7(5)9(10,11)12/h7-8H,3-4,13H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | HBGZURIIFADVNM-BRFYHDHCSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine?
The IUPAC name of (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine (CID 89153784) is (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine.
What is the SMILES notation for (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine?
The canonical SMILES for (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine is CC1=C(C)[C@H](N)CCC1C(F)(F)F.
What is the InChIKey of (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine?
The InChIKey is HBGZURIIFADVNM-BRFYHDHCSA-N. The full InChI is InChI=1S/C9H14F3N/c1-5-6(2)8(13)4-3-7(5)9(10,11)12/h7-8H,3-4,13H2,1-2H3/t7?,8-/m1/s1.
What are the key properties of (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine?
(1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine has a molecular weight of 193.21 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,3-dimethyl-4-(trifluoromethyl)cyclohex-2-en-1-amine is sourced from PubChem (CID 89153784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).