C7H13N3 — CID 89153818
(3E,5E)-6-hydrazinylhepta-1,3,5-trien-3-amine (PubChem CID 89153818) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (3E,5E)-6-hydrazinylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-6-hydrazinylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89153818 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (3E,5E)-6-hydrazinylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C(/C)NN |
| InChI | InChI=1S/C7H13N3/c1-3-7(8)5-4-6(2)10-9/h3-5,10H,1,8-9H2,2H3/b6-4+,7-5+ |
| InChIKey | ULXZMWISLSUGKV-YDFGWWAZSA-N |
| XLogP | 0.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|