About (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine
(3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine (PubChem CID 89153824) has the molecular formula C7H8F3N
and a molecular weight of 163.14 g/mol. Its IUPAC name is (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine |
| PubChem CID | 89153824 |
| Molecular Formula | C7H8F3N |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/N)C(=C)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N/c1-3-4-6(11)5(2)7(8,9)10/h3-4H,1-2,11H2/b6-4+ |
| InChIKey | QYJOIFPEPHLZDV-GQCTYLIASA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine?
The IUPAC name of (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine (CID 89153824) is (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine.
What is the SMILES notation for (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine?
The canonical SMILES for (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine is C=C/C=C(/N)C(=C)C(F)(F)F.
What is the InChIKey of (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine?
The InChIKey is QYJOIFPEPHLZDV-GQCTYLIASA-N. The full InChI is InChI=1S/C7H8F3N/c1-3-4-6(11)5(2)7(8,9)10/h3-4H,1-2,11H2/b6-4+.
What are the key properties of (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine?
(3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine has a molecular weight of 163.14 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-(trifluoromethyl)hexa-1,3,5-trien-3-amine is sourced from PubChem (CID 89153824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).