C16H22N2O — CID 89153827
[[(2Z,4E)-4-(2,3,4,5-tetrahydroindol-1-yl)hepta-2,4,6-trienyl]amino]methanol (PubChem CID 89153827) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is [[(2Z,4E)-4-(2,3,4,5-tetrahydroindol-1-yl)hepta-2,4,6-trienyl]amino]methanol.
| Compound Name | [[(2Z,4E)-4-(2,3,4,5-tetrahydroindol-1-yl)hepta-2,4,6-trienyl]amino]methanol |
|---|---|
| PubChem CID | 89153827 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | [[(2Z,4E)-4-(2,3,4,5-tetrahydroindol-1-yl)hepta-2,4,6-trienyl]amino]methanol |
| SMILES | C=C/C=C(\C=C/CNCO)N1CCC2=C1C=CCC2 |
| InChI | InChI=1S/C16H22N2O/c1-2-6-15(8-5-11-17-13-19)18-12-10-14-7-3-4-9-16(14)18/h2,4-6,8-9,17,19H,1,3,7,10-13H2/b8-5-,15-6+ |
| InChIKey | JQOWKDZKVYVWKX-ZYOIHOCMSA-N |
| XLogP | 2.46 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|