C12H23N3O — CID 89153847
(2E)-1-N-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]penta-2,4-diene-1,2-diamine (PubChem CID 89153847) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (2E)-1-N-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]penta-2,4-diene-1,2-diamine.
| Compound Name | (2E)-1-N-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]penta-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 89153847 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (2E)-1-N-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]penta-2,4-diene-1,2-diamine |
| SMILES | C=C/C=C(/N)CNCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H23N3O/c1-4-5-12(13)6-14-9-15-7-10(2)16-11(3)8-15/h4-5,10-11,14H,1,6-9,13H2,2-3H3/b12-5+/t10-,11+ |
| InChIKey | BDQLSLQXEAMVGP-LVPPLQEZSA-N |
| XLogP | 0.67 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|