About 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine
3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 89153855) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 89153855 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1=CCC(N)C(C)=C1OCC1CC1 |
| InChI | InChI=1S/C12H19NO/c1-8-3-6-11(13)9(2)12(8)14-7-10-4-5-10/h3,10-11H,4-7,13H2,1-2H3 |
| InChIKey | SDXUCFRWGOEKMJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine (CID 89153855) is 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine is CC1=CCC(N)C(C)=C1OCC1CC1.
What is the InChIKey of 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is SDXUCFRWGOEKMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-8-3-6-11(13)9(2)12(8)14-7-10-4-5-10/h3,10-11H,4-7,13H2,1-2H3.
What are the key properties of 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine?
3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 193.29 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethoxy)-2,4-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89153855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).