About 4-aminocyclohexa-2,6-diene-1,2-diol
4-aminocyclohexa-2,6-diene-1,2-diol (PubChem CID 89153872) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 4-aminocyclohexa-2,6-diene-1,2-diol.
Molecular Properties
| Compound Name | 4-aminocyclohexa-2,6-diene-1,2-diol |
| PubChem CID | 89153872 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 4-aminocyclohexa-2,6-diene-1,2-diol |
| SMILES | NC1C=C(O)C(O)=CC1 |
| InChI | InChI=1S/C6H9NO2/c7-4-1-2-5(8)6(9)3-4/h2-4,8-9H,1,7H2 |
| InChIKey | RUYXFMTYTUDXLE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminocyclohexa-2,6-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminocyclohexa-2,6-diene-1,2-diol?
The IUPAC name of 4-aminocyclohexa-2,6-diene-1,2-diol (CID 89153872) is 4-aminocyclohexa-2,6-diene-1,2-diol.
What is the SMILES notation for 4-aminocyclohexa-2,6-diene-1,2-diol?
The canonical SMILES for 4-aminocyclohexa-2,6-diene-1,2-diol is NC1C=C(O)C(O)=CC1.
What is the InChIKey of 4-aminocyclohexa-2,6-diene-1,2-diol?
The InChIKey is RUYXFMTYTUDXLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c7-4-1-2-5(8)6(9)3-4/h2-4,8-9H,1,7H2.
What are the key properties of 4-aminocyclohexa-2,6-diene-1,2-diol?
4-aminocyclohexa-2,6-diene-1,2-diol has a molecular weight of 127.14 g/mol, XLogP of 0.60, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminocyclohexa-2,6-diene-1,2-diol is sourced from PubChem (CID 89153872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).