About (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine
(5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine (PubChem CID 89153880) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine.
Molecular Properties
| Compound Name | (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine |
| PubChem CID | 89153880 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine |
| SMILES | C=CCC(N)/C=C\COC1CCOC1 |
| InChI | InChI=1S/C11H19NO2/c1-2-4-10(12)5-3-7-14-11-6-8-13-9-11/h2-3,5,10-11H,1,4,6-9,12H2/b5-3- |
| InChIKey | AAIVPFJNUDXFQQ-HYXAFXHYSA-N |
| XLogP | 1.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine?
The IUPAC name of (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine (CID 89153880) is (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine.
What is the SMILES notation for (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine?
The canonical SMILES for (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine is C=CCC(N)/C=C\COC1CCOC1.
What is the InChIKey of (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine?
The InChIKey is AAIVPFJNUDXFQQ-HYXAFXHYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-2-4-10(12)5-3-7-14-11-6-8-13-9-11/h2-3,5,10-11H,1,4,6-9,12H2/b5-3-.
What are the key properties of (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine?
(5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine has a molecular weight of 197.28 g/mol, XLogP of 1.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-7-(oxolan-3-yloxy)hepta-1,5-dien-4-amine is sourced from PubChem (CID 89153880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).