C13H22F2N2O — CID 89153883
(5Z)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5,7-difluorohepta-1,5-dien-3-amine (PubChem CID 89153883) has the molecular formula C13H22F2N2O and a molecular weight of 260.33 g/mol. Its IUPAC name is (5Z)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5,7-difluorohepta-1,5-dien-3-amine.
| Compound Name | (5Z)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5,7-difluorohepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 89153883 |
| Molecular Formula | C13H22F2N2O |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (5Z)-6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5,7-difluorohepta-1,5-dien-3-amine |
| SMILES | C=CC(N)C/C(F)=C(\CF)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H22F2N2O/c1-4-11(16)5-12(15)13(6-14)17-7-9(2)18-10(3)8-17/h4,9-11H,1,5-8,16H2,2-3H3/b13-12-/t9-,10+,11? |
| InChIKey | RCTKGNJNYMXEKF-CCUJEJBXSA-N |
| XLogP | 2.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|