C18H34N2 — CID 89153900
(Z,4E)-5-N-(4-ethyl-4-methylhexan-2-yl)-4-prop-2-enylidenehex-2-ene-1,5-diamine (PubChem CID 89153900) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is (Z,4E)-5-N-(4-ethyl-4-methylhexan-2-yl)-4-prop-2-enylidenehex-2-ene-1,5-diamine.
| Compound Name | (Z,4E)-5-N-(4-ethyl-4-methylhexan-2-yl)-4-prop-2-enylidenehex-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 89153900 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | (Z,4E)-5-N-(4-ethyl-4-methylhexan-2-yl)-4-prop-2-enylidenehex-2-ene-1,5-diamine |
| SMILES | C=C/C=C(\C=C/CN)C(C)NC(C)CC(C)(CC)CC |
| InChI | InChI=1S/C18H34N2/c1-7-11-17(12-10-13-19)16(5)20-15(4)14-18(6,8-2)9-3/h7,10-12,15-16,20H,1,8-9,13-14,19H2,2-6H3/b12-10-,17-11+ |
| InChIKey | AFXKJUVQSKHJRA-KCILXYFRSA-N |
| XLogP | 4.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|