C14H23FN2O2 — CID 89153928
N-[(2E)-2-(2,6-dimethylmorpholin-4-yl)-4-fluorohepta-2,6-dienyl]formamide (PubChem CID 89153928) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is N-[(2E)-2-(2,6-dimethylmorpholin-4-yl)-4-fluorohepta-2,6-dienyl]formamide.
| Compound Name | N-[(2E)-2-(2,6-dimethylmorpholin-4-yl)-4-fluorohepta-2,6-dienyl]formamide |
|---|---|
| PubChem CID | 89153928 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-[(2E)-2-(2,6-dimethylmorpholin-4-yl)-4-fluorohepta-2,6-dienyl]formamide |
| SMILES | C=CCC(F)/C=C(\CNC=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C14H23FN2O2/c1-4-5-13(15)6-14(7-16-10-18)17-8-11(2)19-12(3)9-17/h4,6,10-13H,1,5,7-9H2,2-3H3,(H,16,18)/b14-6+ |
| InChIKey | SSIIGWBZTNSLQF-MKMNVTDBSA-N |
| XLogP | 1.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|