C16H32N2O — CID 89153936
7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N,2,6-trimethylhept-1-en-4-amine (PubChem CID 89153936) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N,2,6-trimethylhept-1-en-4-amine.
| Compound Name | 7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N,2,6-trimethylhept-1-en-4-amine |
|---|---|
| PubChem CID | 89153936 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 7-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N,2,6-trimethylhept-1-en-4-amine |
| SMILES | C=C(C)CC(CC(C)CN1C[C@@H](C)O[C@@H](C)C1)NC |
| InChI | InChI=1S/C16H32N2O/c1-12(2)7-16(17-6)8-13(3)9-18-10-14(4)19-15(5)11-18/h13-17H,1,7-11H2,2-6H3/t13?,14-,15+,16? |
| InChIKey | WANDNOWKFXIZIT-IRHLINNNSA-N |
| XLogP | 2.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|