About (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol
(2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol (PubChem CID 89153937) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol |
| PubChem CID | 89153937 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol |
| SMILES | C=C(N)/C=C(\C=C/C)C(O)NC1CCCCC1 |
| InChI | InChI=1S/C14H24N2O/c1-3-7-12(10-11(2)15)14(17)16-13-8-5-4-6-9-13/h3,7,10,13-14,16-17H,2,4-6,8-9,15H2,1H3/b7-3-,12-10+ |
| InChIKey | IIYDXNLTKPFROB-DTFKZNEQSA-N |
| XLogP | 2.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol?
The IUPAC name of (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol (CID 89153937) is (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol.
What is the SMILES notation for (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol?
The canonical SMILES for (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol is C=C(N)/C=C(\C=C/C)C(O)NC1CCCCC1.
What is the InChIKey of (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol?
The InChIKey is IIYDXNLTKPFROB-DTFKZNEQSA-N. The full InChI is InChI=1S/C14H24N2O/c1-3-7-12(10-11(2)15)14(17)16-13-8-5-4-6-9-13/h3,7,10,13-14,16-17H,2,4-6,8-9,15H2,1H3/b7-3-,12-10+.
What are the key properties of (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol?
(2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol has a molecular weight of 236.36 g/mol, XLogP of 2.20, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-amino-1-(cyclohexylamino)-2-[(Z)-prop-1-enyl]penta-2,4-dien-1-ol is sourced from PubChem (CID 89153937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).