C14H24N2 — CID 89153950
(3E,5E)-6-[(5R)-3,5-dimethylpiperidin-1-yl]hepta-1,3,5-trien-3-amine (PubChem CID 89153950) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (3E,5E)-6-[(5R)-3,5-dimethylpiperidin-1-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-6-[(5R)-3,5-dimethylpiperidin-1-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89153950 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (3E,5E)-6-[(5R)-3,5-dimethylpiperidin-1-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C(/C)N1CC(C)C[C@@H](C)C1 |
| InChI | InChI=1S/C14H24N2/c1-5-14(15)7-6-13(4)16-9-11(2)8-12(3)10-16/h5-7,11-12H,1,8-10,15H2,2-4H3/b13-6+,14-7+/t11-,12?/m1/s1 |
| InChIKey | KYIOMTJYODKWPL-UPEPYHHZSA-N |
| XLogP | 2.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|