C9H15NS — CID 89153960
7-methyl-2,3,5,6,7,7a-hexahydro-1-benzothiophen-6-amine (PubChem CID 89153960) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 7-methyl-2,3,5,6,7,7a-hexahydro-1-benzothiophen-6-amine.
| Compound Name | 7-methyl-2,3,5,6,7,7a-hexahydro-1-benzothiophen-6-amine |
|---|---|
| PubChem CID | 89153960 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 7-methyl-2,3,5,6,7,7a-hexahydro-1-benzothiophen-6-amine |
| SMILES | CC1C(N)CC=C2CCSC21 |
| InChI | InChI=1S/C9H15NS/c1-6-8(10)3-2-7-4-5-11-9(6)7/h2,6,8-9H,3-5,10H2,1H3 |
| InChIKey | XRLDECFJKHMVAL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|