About (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine
(4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine (PubChem CID 89153966) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine.
Molecular Properties
| Compound Name | (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine |
| PubChem CID | 89153966 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine |
| SMILES | C=C/C(=C\C(N)CC)OC1CCCC1 |
| InChI | InChI=1S/C12H21NO/c1-3-10(13)9-11(4-2)14-12-7-5-6-8-12/h4,9-10,12H,2-3,5-8,13H2,1H3/b11-9+ |
| InChIKey | IQUYPGPPNXETKI-PKNBQFBNSA-N |
| XLogP | 2.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine?
The IUPAC name of (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine (CID 89153966) is (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine.
What is the SMILES notation for (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine?
The canonical SMILES for (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine is C=C/C(=C\C(N)CC)OC1CCCC1.
What is the InChIKey of (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine?
The InChIKey is IQUYPGPPNXETKI-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H21NO/c1-3-10(13)9-11(4-2)14-12-7-5-6-8-12/h4,9-10,12H,2-3,5-8,13H2,1H3/b11-9+.
What are the key properties of (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine?
(4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine has a molecular weight of 195.31 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-cyclopentyloxyhepta-4,6-dien-3-amine is sourced from PubChem (CID 89153966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).