C10H16F3N — CID 89153967
(4S,5Z)-8,8,8-trifluoro-2,3-dimethylocta-1,5-dien-4-amine (PubChem CID 89153967) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is (4S,5Z)-8,8,8-trifluoro-2,3-dimethylocta-1,5-dien-4-amine.
| Compound Name | (4S,5Z)-8,8,8-trifluoro-2,3-dimethylocta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 89153967 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | (4S,5Z)-8,8,8-trifluoro-2,3-dimethylocta-1,5-dien-4-amine |
| SMILES | C=C(C)C(C)[C@@H](N)/C=C\CC(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c1-7(2)8(3)9(14)5-4-6-10(11,12)13/h4-5,8-9H,1,6,14H2,2-3H3/b5-4-/t8?,9-/m0/s1 |
| InChIKey | VRHRZUYOCXUMCZ-AOVULCPKSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|