About (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine
(3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine (PubChem CID 89153973) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine.
Molecular Properties
| Compound Name | (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine |
| PubChem CID | 89153973 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine |
| SMILES | C#C/C=C(N)\C=C/COC(C)(C)C |
| InChI | InChI=1S/C11H17NO/c1-5-7-10(12)8-6-9-13-11(2,3)4/h1,6-8H,9,12H2,2-4H3/b8-6-,10-7+ |
| InChIKey | IGYCZEOGBHAGOK-GOOBONSCSA-N |
| XLogP | 1.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine?
The IUPAC name of (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine (CID 89153973) is (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine.
What is the SMILES notation for (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine?
The canonical SMILES for (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine is C#C/C=C(N)\C=C/COC(C)(C)C.
What is the InChIKey of (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine?
The InChIKey is IGYCZEOGBHAGOK-GOOBONSCSA-N. The full InChI is InChI=1S/C11H17NO/c1-5-7-10(12)8-6-9-13-11(2,3)4/h1,6-8H,9,12H2,2-4H3/b8-6-,10-7+.
What are the key properties of (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine?
(3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine has a molecular weight of 179.26 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-7-[(2-methylpropan-2-yl)oxy]hepta-3,5-dien-1-yn-4-amine is sourced from PubChem (CID 89153973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).