About (4Z)-2,6-difluorohepta-4,6-dien-1-amine
(4Z)-2,6-difluorohepta-4,6-dien-1-amine (PubChem CID 89154005) has the molecular formula C7H11F2N
and a molecular weight of 147.17 g/mol. Its IUPAC name is (4Z)-2,6-difluorohepta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4Z)-2,6-difluorohepta-4,6-dien-1-amine |
| PubChem CID | 89154005 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (4Z)-2,6-difluorohepta-4,6-dien-1-amine |
| SMILES | C=C(F)/C=C\CC(F)CN |
| InChI | InChI=1S/C7H11F2N/c1-6(8)3-2-4-7(9)5-10/h2-3,7H,1,4-5,10H2/b3-2- |
| InChIKey | KAUNWULCJUDSHB-IHWYPQMZSA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2,6-difluorohepta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2,6-difluorohepta-4,6-dien-1-amine?
The IUPAC name of (4Z)-2,6-difluorohepta-4,6-dien-1-amine (CID 89154005) is (4Z)-2,6-difluorohepta-4,6-dien-1-amine.
What is the SMILES notation for (4Z)-2,6-difluorohepta-4,6-dien-1-amine?
The canonical SMILES for (4Z)-2,6-difluorohepta-4,6-dien-1-amine is C=C(F)/C=C\CC(F)CN.
What is the InChIKey of (4Z)-2,6-difluorohepta-4,6-dien-1-amine?
The InChIKey is KAUNWULCJUDSHB-IHWYPQMZSA-N. The full InChI is InChI=1S/C7H11F2N/c1-6(8)3-2-4-7(9)5-10/h2-3,7H,1,4-5,10H2/b3-2-.
What are the key properties of (4Z)-2,6-difluorohepta-4,6-dien-1-amine?
(4Z)-2,6-difluorohepta-4,6-dien-1-amine has a molecular weight of 147.17 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2,6-difluorohepta-4,6-dien-1-amine is sourced from PubChem (CID 89154005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).