C13H18F4N2O — CID 89154031
(3Z,5Z)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3,5-trien-3-amine (PubChem CID 89154031) has the molecular formula C13H18F4N2O and a molecular weight of 294.29 g/mol. Its IUPAC name is (3Z,5Z)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5Z)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89154031 |
| Molecular Formula | C13H18F4N2O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (3Z,5Z)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3,5-trien-3-amine |
| SMILES | C=C(F)/C(N)=C(F)\C(F)=C(/CF)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C13H18F4N2O/c1-7-5-19(6-8(2)20-7)10(4-14)11(16)12(17)13(18)9(3)15/h7-8H,3-6,18H2,1-2H3/b11-10-,13-12- |
| InChIKey | YNATVDGMMCGWOJ-FQEMRORKSA-N |
| XLogP | 2.87 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|