C13H23FN2O — CID 89154041
(5E)-7-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluorohepta-1,5-dien-4-amine (PubChem CID 89154041) has the molecular formula C13H23FN2O and a molecular weight of 242.34 g/mol. Its IUPAC name is (5E)-7-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluorohepta-1,5-dien-4-amine.
| Compound Name | (5E)-7-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluorohepta-1,5-dien-4-amine |
|---|---|
| PubChem CID | 89154041 |
| Molecular Formula | C13H23FN2O |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (5E)-7-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-6-fluorohepta-1,5-dien-4-amine |
| SMILES | C=CCC(N)/C=C(/F)CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H23FN2O/c1-4-5-13(15)6-12(14)9-16-7-10(2)17-11(3)8-16/h4,6,10-11,13H,1,5,7-9,15H2,2-3H3/b12-6+/t10-,11+,13? |
| InChIKey | OPZYFRSTAAAXAC-SFVIIJALSA-N |
| XLogP | 1.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|