About 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol
1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol (PubChem CID 89154049) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol.
Molecular Properties
| Compound Name | 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol |
| PubChem CID | 89154049 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol |
| SMILES | C=C/C(=C\CCN)N1CCCCC1O |
| InChI | InChI=1S/C11H20N2O/c1-2-10(6-5-8-12)13-9-4-3-7-11(13)14/h2,6,11,14H,1,3-5,7-9,12H2/b10-6+ |
| InChIKey | KEZBWNLGCXBBJT-UXBLZVDNSA-N |
| XLogP | 1.21 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol?
The IUPAC name of 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol (CID 89154049) is 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol.
What is the SMILES notation for 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol?
The canonical SMILES for 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol is C=C/C(=C\CCN)N1CCCCC1O.
What is the InChIKey of 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol?
The InChIKey is KEZBWNLGCXBBJT-UXBLZVDNSA-N. The full InChI is InChI=1S/C11H20N2O/c1-2-10(6-5-8-12)13-9-4-3-7-11(13)14/h2,6,11,14H,1,3-5,7-9,12H2/b10-6+.
What are the key properties of 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol?
1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol has a molecular weight of 196.29 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-6-aminohexa-1,3-dien-3-yl]piperidin-2-ol is sourced from PubChem (CID 89154049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).