About 5-butoxycyclohexa-1,3-dien-1-amine
5-butoxycyclohexa-1,3-dien-1-amine (PubChem CID 89154063) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 5-butoxycyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5-butoxycyclohexa-1,3-dien-1-amine |
| PubChem CID | 89154063 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 5-butoxycyclohexa-1,3-dien-1-amine |
| SMILES | CCCCOC1C=CC=C(N)C1 |
| InChI | InChI=1S/C10H17NO/c1-2-3-7-12-10-6-4-5-9(11)8-10/h4-6,10H,2-3,7-8,11H2,1H3 |
| InChIKey | RDKHKHPNODSQFX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxycyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxycyclohexa-1,3-dien-1-amine?
The IUPAC name of 5-butoxycyclohexa-1,3-dien-1-amine (CID 89154063) is 5-butoxycyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5-butoxycyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5-butoxycyclohexa-1,3-dien-1-amine is CCCCOC1C=CC=C(N)C1.
What is the InChIKey of 5-butoxycyclohexa-1,3-dien-1-amine?
The InChIKey is RDKHKHPNODSQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-2-3-7-12-10-6-4-5-9(11)8-10/h4-6,10H,2-3,7-8,11H2,1H3.
What are the key properties of 5-butoxycyclohexa-1,3-dien-1-amine?
5-butoxycyclohexa-1,3-dien-1-amine has a molecular weight of 167.25 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxycyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89154063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).