C17H24N2O — CID 89154078
4-amino-N-[(3E,5Z)-2,5-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 89154078) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-amino-N-[(3E,5Z)-2,5-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 4-amino-N-[(3E,5Z)-2,5-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 89154078 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-amino-N-[(3E,5Z)-2,5-dimethylocta-1,3,5-trien-3-yl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=C(C)/C(=C\C(C)=C/CC)NC(=O)C1=CCC(N)C=C1 |
| InChI | InChI=1S/C17H24N2O/c1-5-6-13(4)11-16(12(2)3)19-17(20)14-7-9-15(18)10-8-14/h6-9,11,15H,2,5,10,18H2,1,3-4H3,(H,19,20)/b13-6-,16-11+ |
| InChIKey | AHTHNNMHELRLKK-LRVCSTJASA-N |
| XLogP | 3.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|