C12H18N2O — CID 89154088
1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]piperazin-2-one (PubChem CID 89154088) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]piperazin-2-one.
| Compound Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]piperazin-2-one |
|---|---|
| PubChem CID | 89154088 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]piperazin-2-one |
| SMILES | C=C(C)/C=C\C(=C/C)N1CCNCC1=O |
| InChI | InChI=1S/C12H18N2O/c1-4-11(6-5-10(2)3)14-8-7-13-9-12(14)15/h4-6,13H,2,7-9H2,1,3H3/b6-5-,11-4- |
| InChIKey | HJJCSZYDOKSITC-XJPIMNPLSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|