C12H21N3O — CID 89154109
(1E,3E)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]hexa-1,3,5-triene-1,4-diamine (PubChem CID 89154109) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is (1E,3E)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]hexa-1,3,5-triene-1,4-diamine.
| Compound Name | (1E,3E)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]hexa-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 89154109 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (1E,3E)-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]hexa-1,3,5-triene-1,4-diamine |
| SMILES | C=C/C(N)=C\C=C(/N)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H21N3O/c1-4-11(13)5-6-12(14)15-7-9(2)16-10(3)8-15/h4-6,9-10H,1,7-8,13-14H2,2-3H3/b11-5+,12-6+/t9-,10+ |
| InChIKey | NOBSQOFDNGVNLR-JKISZPCSSA-N |
| XLogP | 0.92 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|