C14H20F4N2O2 — CID 89154126
N-[(3Z,5R)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3-dien-3-yl]formamide (PubChem CID 89154126) has the molecular formula C14H20F4N2O2 and a molecular weight of 324.32 g/mol. Its IUPAC name is N-[(3Z,5R)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3-dien-3-yl]formamide.
| Compound Name | N-[(3Z,5R)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3-dien-3-yl]formamide |
|---|---|
| PubChem CID | 89154126 |
| Molecular Formula | C14H20F4N2O2 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(3Z,5R)-6-(2,6-dimethylmorpholin-4-yl)-2,4,5,7-tetrafluorohepta-1,3-dien-3-yl]formamide |
| SMILES | C=C(F)/C(NC=O)=C(/F)[C@H](F)C(CF)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C14H20F4N2O2/c1-8-5-20(6-9(2)22-8)11(4-15)12(17)13(18)14(10(3)16)19-7-21/h7-9,11-12H,3-6H2,1-2H3,(H,19,21)/b14-13-/t8?,9?,11?,12-/m1/s1 |
| InChIKey | QGSQPMFWYYUIKV-CXRXTIQNSA-N |
| XLogP | 2.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|