C14H21N — CID 89154169
1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-2-methylidenepiperidine (PubChem CID 89154169) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-2-methylidenepiperidine.
| Compound Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-2-methylidenepiperidine |
|---|---|
| PubChem CID | 89154169 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-2-methylidenepiperidine |
| SMILES | C=C(C)/C=C\C(=C/C)N1CCCCC1=C |
| InChI | InChI=1S/C14H21N/c1-5-14(10-9-12(2)3)15-11-7-6-8-13(15)4/h5,9-10H,2,4,6-8,11H2,1,3H3/b10-9-,14-5- |
| InChIKey | XPZSLQJICXIVDU-GGKIZDKJSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|