About 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole
4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole (PubChem CID 89154188) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole.
Molecular Properties
| Compound Name | 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole |
| PubChem CID | 89154188 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole |
| SMILES | C/C=C\c1[nH]cc(C)c1/C=C\C |
| InChI | InChI=1S/C11H15N/c1-4-6-10-9(3)8-12-11(10)7-5-2/h4-8,12H,1-3H3/b6-4-,7-5- |
| InChIKey | JJNNBKZHRDTGAZ-PEPZGXQESA-N |
| XLogP | 3.39 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole?
The IUPAC name of 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole (CID 89154188) is 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole.
What is the SMILES notation for 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole?
The canonical SMILES for 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole is C/C=C\c1[nH]cc(C)c1/C=C\C.
What is the InChIKey of 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole?
The InChIKey is JJNNBKZHRDTGAZ-PEPZGXQESA-N. The full InChI is InChI=1S/C11H15N/c1-4-6-10-9(3)8-12-11(10)7-5-2/h4-8,12H,1-3H3/b6-4-,7-5-.
What are the key properties of 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole?
4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole has a molecular weight of 161.25 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-bis[(Z)-prop-1-enyl]-1H-pyrrole is sourced from PubChem (CID 89154188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).