C27H26N6O2S2 — CID 89154487
1-[4-(5-methylsulfanyl-4-morpholin-4-yl-6-pyridin-3-ylpyrimidin-2-yl)phenyl]-3-phenyl-1-sulfanylurea (PubChem CID 89154487) has the molecular formula C27H26N6O2S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is 1-[4-(5-methylsulfanyl-4-morpholin-4-yl-6-pyridin-3-ylpyrimidin-2-yl)phenyl]-3-phenyl-1-sulfanylurea.
| Compound Name | 1-[4-(5-methylsulfanyl-4-morpholin-4-yl-6-pyridin-3-ylpyrimidin-2-yl)phenyl]-3-phenyl-1-sulfanylurea |
|---|---|
| PubChem CID | 89154487 |
| Molecular Formula | C27H26N6O2S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-[4-(5-methylsulfanyl-4-morpholin-4-yl-6-pyridin-3-ylpyrimidin-2-yl)phenyl]-3-phenyl-1-sulfanylurea |
| SMILES | CSc1c(-c2cccnc2)nc(-c2ccc(N(S)C(=O)Nc3ccccc3)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C27H26N6O2S2/c1-37-24-23(20-6-5-13-28-18-20)30-25(31-26(24)32-14-16-35-17-15-32)19-9-11-22(12-10-19)33(36)27(34)29-21-7-3-2-4-8-21/h2-13,18,36H,14-17H2,1H3,(H,29,34) |
| InChIKey | AZCDIZJJFRVXLK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|