C18H18N4O4S2 — CID 89154561
6-[4-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienoxy]phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide (PubChem CID 89154561) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 6-[4-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienoxy]phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide.
| Compound Name | 6-[4-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienoxy]phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 89154561 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 6-[4-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienoxy]phenyl]imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
| SMILES | C/C=C\C(=C/C=C/Oc1ccc(-c2cn3nc(S(N)(=O)=O)sc3n2)cc1)OC |
| InChI | InChI=1S/C18H18N4O4S2/c1-3-5-14(25-2)6-4-11-26-15-9-7-13(8-10-15)16-12-22-17(20-16)27-18(21-22)28(19,23)24/h3-12H,1-2H3,(H2,19,23,24)/b5-3-,11-4+,14-6+ |
| InChIKey | HPQNRBGHUGKRMW-QMFYXTCASA-N |
| XLogP | 3.10 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|