About CID 89154623
CID 89154623 (PubChem CID 89154623) has the molecular formula C20H18BN3O3
and a molecular weight of 359.19 g/mol.
Molecular Properties
| Compound Name | CID 89154623 |
| PubChem CID | 89154623 |
| Molecular Formula | C20H18BN3O3 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(C(=O)N3CCc4c(ccc5c4OCCO5)C3C)nn2c1 |
| InChI | InChI=1S/C20H18BN3O3/c1-12-15-4-5-18-19(27-9-8-26-18)16(15)6-7-23(12)20(25)17-10-14-3-2-13(21)11-24(14)22-17/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | XZSYUNWUVPQWAI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89154623 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89154623?
The IUPAC name of CID 89154623 (CID 89154623) is not available.
What is the SMILES notation for CID 89154623?
The canonical SMILES for CID 89154623 is [B]c1ccc2cc(C(=O)N3CCc4c(ccc5c4OCCO5)C3C)nn2c1.
What is the InChIKey of CID 89154623?
The InChIKey is XZSYUNWUVPQWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BN3O3/c1-12-15-4-5-18-19(27-9-8-26-18)16(15)6-7-23(12)20(25)17-10-14-3-2-13(21)11-24(14)22-17/h2-5,10-12H,6-9H2,1H3.
What are the key properties of CID 89154623?
CID 89154623 has a molecular weight of 359.19 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89154623 is sourced from PubChem (CID 89154623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).