C22H20F5NO5 — CID 89154864
N-formyl-2-methoxy-2-[(4R)-7-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]acetamide (PubChem CID 89154864) has the molecular formula C22H20F5NO5 and a molecular weight of 473.39 g/mol. Its IUPAC name is N-formyl-2-methoxy-2-[(4R)-7-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]acetamide.
| Compound Name | N-formyl-2-methoxy-2-[(4R)-7-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]acetamide |
|---|---|
| PubChem CID | 89154864 |
| Molecular Formula | C22H20F5NO5 |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-formyl-2-methoxy-2-[(4R)-7-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3,4-dihydro-2H-chromen-4-yl]acetamide |
| SMILES | COC(C(=O)NC=O)[C@@H]1CCOc2cc(Oc3ccc(C(F)(F)C(F)(F)F)cc3C)ccc21 |
| InChI | InChI=1S/C22H20F5NO5/c1-12-9-13(21(23,24)22(25,26)27)3-6-17(12)33-14-4-5-15-16(7-8-32-18(15)10-14)19(31-2)20(30)28-11-29/h3-6,9-11,16,19H,7-8H2,1-2H3,(H,28,29,30)/t16-,19?/m1/s1 |
| InChIKey | OHBXTOXIMSUQMX-VTBWFHPJSA-N |
| XLogP | 4.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|