C23H20N2O4 — CID 89154929
(5R)-5-[(1R)-6-(4-aminonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-2,4-dione (PubChem CID 89154929) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (5R)-5-[(1R)-6-(4-aminonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1R)-6-(4-aminonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 89154929 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (5R)-5-[(1R)-6-(4-aminonaphthalen-1-yl)oxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3-oxazolidine-2,4-dione |
| SMILES | Nc1ccc(Oc2ccc3c(c2)CCC[C@H]3[C@H]2OC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C23H20N2O4/c24-19-10-11-20(17-6-2-1-5-16(17)19)28-14-8-9-15-13(12-14)4-3-7-18(15)21-22(26)25-23(27)29-21/h1-2,5-6,8-12,18,21H,3-4,7,24H2,(H,25,26,27)/t18-,21-/m1/s1 |
| InChIKey | NWTPVMBWAHHHGU-WIYYLYMNSA-N |
| XLogP | 4.27 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|