About 6-acetylpiperidine-2,4-dione
6-acetylpiperidine-2,4-dione (PubChem CID 89154967) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 6-acetylpiperidine-2,4-dione.
Molecular Properties
| Compound Name | 6-acetylpiperidine-2,4-dione |
| PubChem CID | 89154967 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 6-acetylpiperidine-2,4-dione |
| SMILES | CC(=O)C1CC(=O)CC(=O)N1 |
| InChI | InChI=1S/C7H9NO3/c1-4(9)6-2-5(10)3-7(11)8-6/h6H,2-3H2,1H3,(H,8,11) |
| InChIKey | BOGNEWAPLACTET-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-acetylpiperidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetylpiperidine-2,4-dione?
The IUPAC name of 6-acetylpiperidine-2,4-dione (CID 89154967) is 6-acetylpiperidine-2,4-dione.
What is the SMILES notation for 6-acetylpiperidine-2,4-dione?
The canonical SMILES for 6-acetylpiperidine-2,4-dione is CC(=O)C1CC(=O)CC(=O)N1.
What is the InChIKey of 6-acetylpiperidine-2,4-dione?
The InChIKey is BOGNEWAPLACTET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-4(9)6-2-5(10)3-7(11)8-6/h6H,2-3H2,1H3,(H,8,11).
What are the key properties of 6-acetylpiperidine-2,4-dione?
6-acetylpiperidine-2,4-dione has a molecular weight of 155.15 g/mol, XLogP of -0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetylpiperidine-2,4-dione is sourced from PubChem (CID 89154967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).