C22H44N4 — CID 89155198
1-[(1-hexylpiperidin-4-yl)methyl]-4,5,5-trimethyl-4-(2-methylpropyl)imidazol-2-amine (PubChem CID 89155198) has the molecular formula C22H44N4 and a molecular weight of 364.62 g/mol. Its IUPAC name is 1-[(1-hexylpiperidin-4-yl)methyl]-4,5,5-trimethyl-4-(2-methylpropyl)imidazol-2-amine.
| Compound Name | 1-[(1-hexylpiperidin-4-yl)methyl]-4,5,5-trimethyl-4-(2-methylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 89155198 |
| Molecular Formula | C22H44N4 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | 1-[(1-hexylpiperidin-4-yl)methyl]-4,5,5-trimethyl-4-(2-methylpropyl)imidazol-2-amine |
| SMILES | CCCCCCN1CCC(CN2C(N)=NC(C)(CC(C)C)C2(C)C)CC1 |
| InChI | InChI=1S/C22H44N4/c1-7-8-9-10-13-25-14-11-19(12-15-25)17-26-20(23)24-22(6,16-18(2)3)21(26,4)5/h18-19H,7-17H2,1-6H3,(H2,23,24) |
| InChIKey | TXODDPPWBJXFIG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|