About (Z)-hept-2-en-4-imine
(Z)-hept-2-en-4-imine (PubChem CID 89155423) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is (Z)-hept-2-en-4-imine.
Molecular Properties
| Compound Name | (Z)-hept-2-en-4-imine |
| PubChem CID | 89155423 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (Z)-hept-2-en-4-imine |
| SMILES | [H]/N=C(/C=C\C)CCC |
| InChI | InChI=1S/C7H13N/c1-3-5-7(8)6-4-2/h3,5,8H,4,6H2,1-2H3/b5-3-,8-7- |
| InChIKey | TZYIUVXUDJCPHZ-OVRZELKPSA-N |
| XLogP | 2.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-hept-2-en-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-hept-2-en-4-imine?
The IUPAC name of (Z)-hept-2-en-4-imine (CID 89155423) is (Z)-hept-2-en-4-imine.
What is the SMILES notation for (Z)-hept-2-en-4-imine?
The canonical SMILES for (Z)-hept-2-en-4-imine is [H]/N=C(/C=C\C)CCC.
What is the InChIKey of (Z)-hept-2-en-4-imine?
The InChIKey is TZYIUVXUDJCPHZ-OVRZELKPSA-N. The full InChI is InChI=1S/C7H13N/c1-3-5-7(8)6-4-2/h3,5,8H,4,6H2,1-2H3/b5-3-,8-7-.
What are the key properties of (Z)-hept-2-en-4-imine?
(Z)-hept-2-en-4-imine has a molecular weight of 111.19 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hept-2-en-4-imine is sourced from PubChem (CID 89155423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).