About 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one
4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one (PubChem CID 89155667) has the molecular formula C15H7F3N4OS
and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one |
| PubChem CID | 89155667 |
| Molecular Formula | C15H7F3N4OS |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one |
| SMILES | [N-]=[N+]=Nc1c(-c2ccccc2C(F)(F)F)c(=O)sc2cccnc12 |
| InChI | InChI=1S/C15H7F3N4OS/c16-15(17,18)9-5-2-1-4-8(9)11-13(21-22-19)12-10(24-14(11)23)6-3-7-20-12/h1-7H |
| InChIKey | ITPWMTBBRXHOLA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one?
The IUPAC name of 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one (CID 89155667) is 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one.
What is the SMILES notation for 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one?
The canonical SMILES for 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one is [N-]=[N+]=Nc1c(-c2ccccc2C(F)(F)F)c(=O)sc2cccnc12.
What is the InChIKey of 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one?
The InChIKey is ITPWMTBBRXHOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F3N4OS/c16-15(17,18)9-5-2-1-4-8(9)11-13(21-22-19)12-10(24-14(11)23)6-3-7-20-12/h1-7H.
What are the key properties of 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one?
4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one has a molecular weight of 348.31 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-3-[2-(trifluoromethyl)phenyl]thiopyrano[3,2-b]pyridin-2-one is sourced from PubChem (CID 89155667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).