C25H25N5O2S — CID 89155993
2-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]-1-(2-methylaziridin-1-yl)ethanone (PubChem CID 89155993) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is 2-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]-1-(2-methylaziridin-1-yl)ethanone.
| Compound Name | 2-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]-1-(2-methylaziridin-1-yl)ethanone |
|---|---|
| PubChem CID | 89155993 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-[3-[1-[[6-(1,3-benzothiazol-6-yl)-2-methylpyrimidin-4-yl]amino]ethyl]phenoxy]-1-(2-methylaziridin-1-yl)ethanone |
| SMILES | Cc1nc(NC(C)c2cccc(OCC(=O)N3CC3C)c2)cc(-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C25H25N5O2S/c1-15-12-30(15)25(31)13-32-20-6-4-5-18(9-20)16(2)27-24-11-22(28-17(3)29-24)19-7-8-21-23(10-19)33-14-26-21/h4-11,14-16H,12-13H2,1-3H3,(H,27,28,29) |
| InChIKey | ARFHQLKLKKOGCX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|